automap: IndigoException: array: memory to reserve is large than allowed threshold

IndigoException: array: memory to reserve (134217724 x 16) is large than allowed threshold

I try to add map for the raction,
```py
from indigo import *
indigo = Indigo()
def addmapbyINDIGO(rxnsmi):
smi = rxnsmi
rxn = indigo.loadReaction(smi)
rxn.automap('discard ignore_charges ignore_isotopes ignore_valence ignore_radicals')
# rxn.automap()

rxnsmi_map_indigo = rxn.smiles()
return rxnsmi_map_indigo
rxnsmi='CC(C)(C)c1cc(CCc2cc(CCc3cc(CO)cc(CCc4cc(CCc5cc(C(C)(C)C)cc(C(C)(C)C)c5)cc(CCc5cc(C(C)(C)C)cc(C(C)(C)C)c5)c4)c3)cc(CCc3cc(C(C)(C)C)cc(C(C)(C)C)c3)c2)cc(C(C)(C)C)c1>>CC(C)(C)c1cc(CCc2cc(CCc3cc(C=O)cc(CCc4cc(CCc5cc(C(C)(C)C)cc(C(C)(C)C)c5)cc(CCc5cc(C(C)(C)C)cc(C(C)(C)C)c5)c4)c3)cc(CCc3cc(C(C)(C)C)cc(C(C)(C)C)c3)c2)cc(C(C)(C)C)c1'
addmapbyINDIGO(rxnsmi)
```
it raise the error.
```
IndigoException: array: memory to reserve (134217724 x 16) is large than allowed threshold

```